C16H17F2N3O3 — CID 166299903
N'-(1,1-difluoro-4-hydroxybutan-2-yl)-N'-methyl-N-quinolin-6-yloxamide (PubChem CID 166299903) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is N'-(1,1-difluoro-4-hydroxybutan-2-yl)-N'-methyl-N-quinolin-6-yloxamide.
| Compound Name | N'-(1,1-difluoro-4-hydroxybutan-2-yl)-N'-methyl-N-quinolin-6-yloxamide |
|---|---|
| PubChem CID | 166299903 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | N'-(1,1-difluoro-4-hydroxybutan-2-yl)-N'-methyl-N-quinolin-6-yloxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc2ncccc2c1)C(CCO)C(F)F |
| InChI | InChI=1S/C16H17F2N3O3/c1-21(13(6-8-22)14(17)18)16(24)15(23)20-11-4-5-12-10(9-11)3-2-7-19-12/h2-5,7,9,13-14,22H,6,8H2,1H3,(H,20,23) |
| InChIKey | BCVDSSUTVHLOJO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|