C14H19N5O2S — CID 166303936
trans-(1R,3R)-N,2,2-trimethyl-3-(4-methyl-1,3-thiazol-2-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide (PubChem CID 166303936) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is trans-(1R,3R)-N,2,2-trimethyl-3-(4-methyl-1,3-thiazol-2-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,3R)-N,2,2-trimethyl-3-(4-methyl-1,3-thiazol-2-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166303936 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | trans-(1R,3R)-N,2,2-trimethyl-3-(4-methyl-1,3-thiazol-2-yl)-N-[(5-oxo-1,4-dihydro-1,2,4-triazol-3-yl)methyl]cyclopropane-1-carboxamide |
| SMILES | Cc1csc([C@@H]2[C@@H](C(=O)N(C)Cc3n[nH]c(=O)[nH]3)C2(C)C)n1 |
| InChI | InChI=1S/C14H19N5O2S/c1-7-6-22-11(15-7)9-10(14(9,2)3)12(20)19(4)5-8-16-13(21)18-17-8/h6,9-10H,5H2,1-4H3,(H2,16,17,18,21)/t9-,10-/m0/s1 |
| InChIKey | OGFGUQQTZPXLNM-UWVGGRQHSA-N |
| XLogP | 1.26 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |