C11H10N2O4 — CID 166308075
5-[1-(furan-3-carbonyl)azetidin-3-yl]-1,2-oxazol-3-one (PubChem CID 166308075) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is 5-[1-(furan-3-carbonyl)azetidin-3-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[1-(furan-3-carbonyl)azetidin-3-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 166308075 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 5-[1-(furan-3-carbonyl)azetidin-3-yl]-1,2-oxazol-3-one |
| SMILES | O=C(c1ccoc1)N1CC(c2cc(=O)[nH]o2)C1 |
| InChI | InChI=1S/C11H10N2O4/c14-10-3-9(17-12-10)8-4-13(5-8)11(15)7-1-2-16-6-7/h1-3,6,8H,4-5H2,(H,12,14) |
| InChIKey | OBTMAXHULIFGNY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |