C15H15F3N4S — CID 166317023
N-[(2-methyl-3H-benzimidazol-5-yl)methyl]-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 166317023) has the molecular formula C15H15F3N4S and a molecular weight of 340.37 g/mol. Its IUPAC name is N-[(2-methyl-3H-benzimidazol-5-yl)methyl]-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | N-[(2-methyl-3H-benzimidazol-5-yl)methyl]-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 166317023 |
| Molecular Formula | C15H15F3N4S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[(2-methyl-3H-benzimidazol-5-yl)methyl]-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | Cc1nc2ccc(CNCCc3nc(C(F)(F)F)cs3)cc2[nH]1 |
| InChI | InChI=1S/C15H15F3N4S/c1-9-20-11-3-2-10(6-12(11)21-9)7-19-5-4-14-22-13(8-23-14)15(16,17)18/h2-3,6,8,19H,4-5,7H2,1H3,(H,20,21) |
| InChIKey | JKARXMCVRRZKRG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|