C19H15FN4O2 — CID 166321402
3-N-(2-benzylpyrimidin-4-yl)-4-fluorobenzene-1,3-dicarboxamide (PubChem CID 166321402) has the molecular formula C19H15FN4O2 and a molecular weight of 350.35 g/mol. Its IUPAC name is 3-N-(2-benzylpyrimidin-4-yl)-4-fluorobenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2-benzylpyrimidin-4-yl)-4-fluorobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 166321402 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-N-(2-benzylpyrimidin-4-yl)-4-fluorobenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1ccc(F)c(C(=O)Nc2ccnc(Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C19H15FN4O2/c20-15-7-6-13(18(21)25)11-14(15)19(26)24-16-8-9-22-17(23-16)10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H2,21,25)(H,22,23,24,26) |
| InChIKey | COJQBSNHQUNYOP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |