C27H30BrN3O3 — CID 166324955
N'-(1-adamantylmethyl)-N-[3-[(4-bromobenzoyl)amino]phenyl]-N'-methyloxamide (PubChem CID 166324955) has the molecular formula C27H30BrN3O3 and a molecular weight of 524.46 g/mol. Its IUPAC name is N'-(1-adamantylmethyl)-N-[3-[(4-bromobenzoyl)amino]phenyl]-N'-methyloxamide.
| Compound Name | N'-(1-adamantylmethyl)-N-[3-[(4-bromobenzoyl)amino]phenyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 166324955 |
| Molecular Formula | C27H30BrN3O3 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N'-(1-adamantylmethyl)-N-[3-[(4-bromobenzoyl)amino]phenyl]-N'-methyloxamide |
| SMILES | CN(CC12CC3CC(CC(C3)C1)C2)C(=O)C(=O)Nc1cccc(NC(=O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C27H30BrN3O3/c1-31(16-27-13-17-9-18(14-27)11-19(10-17)15-27)26(34)25(33)30-23-4-2-3-22(12-23)29-24(32)20-5-7-21(28)8-6-20/h2-8,12,17-19H,9-11,13-16H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | HCJSJLILYFLDAN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|