C18H12BrN3O2 — CID 166329475
5-(4-bromophenyl)-3-isoquinolin-4-ylimidazolidine-2,4-dione (PubChem CID 166329475) has the molecular formula C18H12BrN3O2 and a molecular weight of 382.22 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-isoquinolin-4-ylimidazolidine-2,4-dione.
| Compound Name | 5-(4-bromophenyl)-3-isoquinolin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166329475 |
| Molecular Formula | C18H12BrN3O2 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 5-(4-bromophenyl)-3-isoquinolin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccc(Br)cc2)C(=O)N1c1cncc2ccccc12 |
| InChI | InChI=1S/C18H12BrN3O2/c19-13-7-5-11(6-8-13)16-17(23)22(18(24)21-16)15-10-20-9-12-3-1-2-4-14(12)15/h1-10,16H,(H,21,24) |
| InChIKey | LBZMDHQRWUHPOV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|