C22H19ClN4O2 — CID 171902625
7-(2-chlorophenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-pyrido[3,2-d]pyrimidine-2,4-dione (PubChem CID 171902625) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-pyrido[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 7-(2-chlorophenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171902625 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 7-(2-chlorophenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-pyrido[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC2CC(c3ccccc3Cl)CNC2C(=O)N1c1cncc2ccccc12 |
| InChI | InChI=1S/C22H19ClN4O2/c23-17-8-4-3-6-15(17)14-9-18-20(25-11-14)21(28)27(22(29)26-18)19-12-24-10-13-5-1-2-7-16(13)19/h1-8,10,12,14,18,20,25H,9,11H2,(H,26,29) |
| InChIKey | SAFQPFKHHSGGOO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |