C25H23ClN4O4 — CID 171902685
2-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenoxy]acetamide (PubChem CID 171902685) has the molecular formula C25H23ClN4O4 and a molecular weight of 478.94 g/mol. Its IUPAC name is 2-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenoxy]acetamide.
| Compound Name | 2-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 171902685 |
| Molecular Formula | C25H23ClN4O4 |
| Molecular Weight | 478.94 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | 2-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenoxy]acetamide |
| SMILES | NC(=O)COc1cccc(Cl)c1C1CCC2C(=O)N(c3cncc4ccccc34)C(=O)NC2C1 |
| InChI | InChI=1S/C25H23ClN4O4/c26-18-6-3-7-21(34-13-22(27)31)23(18)14-8-9-17-19(10-14)29-25(33)30(24(17)32)20-12-28-11-15-4-1-2-5-16(15)20/h1-7,11-12,14,17,19H,8-10,13H2,(H2,27,31)(H,29,33) |
| InChIKey | QXKGLRZSVLWJCA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |