C26H22ClFN4O3 — CID 171903441
2-[7-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetonitrile (PubChem CID 171903441) has the molecular formula C26H22ClFN4O3 and a molecular weight of 492.94 g/mol. Its IUPAC name is 2-[7-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetonitrile.
| Compound Name | 2-[7-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 171903441 |
| Molecular Formula | C26H22ClFN4O3 |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[7-(2-chloro-4-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetonitrile |
| SMILES | COc1cc(C2CCC3C(=O)N(c4cncc5ccccc45)C(=O)N(CC#N)C3C2)c(Cl)cc1F |
| InChI | InChI=1S/C26H22ClFN4O3/c1-35-24-11-19(20(27)12-21(24)28)15-6-7-18-22(10-15)31(9-8-29)26(34)32(25(18)33)23-14-30-13-16-4-2-3-5-17(16)23/h2-5,11-15,18,22H,6-7,9-10H2,1H3 |
| InChIKey | HKWYZXOTNSPQLI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 86.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|