C25H22N4O3 — CID 171902896
2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile (PubChem CID 171902896) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile.
| Compound Name | 2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 171902896 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)c(C2CCC3C(=O)N(c4cncc5ccccc45)C(=O)NC3C2)c1 |
| InChI | InChI=1S/C25H22N4O3/c1-32-18-8-6-16(12-26)21(11-18)15-7-9-20-22(10-15)28-25(31)29(24(20)30)23-14-27-13-17-4-2-3-5-19(17)23/h2-6,8,11,13-15,20,22H,7,9-10H2,1H3,(H,28,31) |
| InChIKey | PGZIZPDXZUJMCM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |