C30H31ClN4O4 — CID 171902998
7-(2-chloro-5-methoxyphenyl)-3-[6-(6-oxa-2-azaspiro[3.4]octan-2-yl)isoquinolin-4-yl]-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902998) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is 7-(2-chloro-5-methoxyphenyl)-3-[6-(6-oxa-2-azaspiro[3.4]octan-2-yl)isoquinolin-4-yl]-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 7-(2-chloro-5-methoxyphenyl)-3-[6-(6-oxa-2-azaspiro[3.4]octan-2-yl)isoquinolin-4-yl]-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902998 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 7-(2-chloro-5-methoxyphenyl)-3-[6-(6-oxa-2-azaspiro[3.4]octan-2-yl)isoquinolin-4-yl]-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc(Cl)c(C2CCC3C(=O)N(c4cncc5ccc(N6CC7(CCOC7)C6)cc45)C(=O)NC3C2)c1 |
| InChI | InChI=1S/C30H31ClN4O4/c1-38-21-5-7-25(31)23(12-21)18-3-6-22-26(10-18)33-29(37)35(28(22)36)27-14-32-13-19-2-4-20(11-24(19)27)34-15-30(16-34)8-9-39-17-30/h2,4-5,7,11-14,18,22,26H,3,6,8-10,15-17H2,1H3,(H,33,37) |
| InChIKey | HENMSQZIIHQSHF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |