C24H22ClN3O3 — CID 171902825
7-(2-chlorophenyl)-3-(6-methoxyisoquinolin-4-yl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902825) has the molecular formula C24H22ClN3O3 and a molecular weight of 435.91 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-3-(6-methoxyisoquinolin-4-yl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 7-(2-chlorophenyl)-3-(6-methoxyisoquinolin-4-yl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902825 |
| Molecular Formula | C24H22ClN3O3 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 7-(2-chlorophenyl)-3-(6-methoxyisoquinolin-4-yl)-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | COc1ccc2cncc(N3C(=O)NC4CC(c5ccccc5Cl)CCC4C3=O)c2c1 |
| InChI | InChI=1S/C24H22ClN3O3/c1-31-16-8-6-15-12-26-13-22(19(15)11-16)28-23(29)18-9-7-14(10-21(18)27-24(28)30)17-4-2-3-5-20(17)25/h2-6,8,11-14,18,21H,7,9-10H2,1H3,(H,27,30) |
| InChIKey | NTEACCBDTSHINT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |