C23H18ClN3O4 — CID 171502926
methyl 4-[2-(2-chlorophenyl)-6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl]isoquinoline-6-carboxylate (PubChem CID 171502926) has the molecular formula C23H18ClN3O4 and a molecular weight of 435.87 g/mol. Its IUPAC name is methyl 4-[2-(2-chlorophenyl)-6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl]isoquinoline-6-carboxylate.
| Compound Name | methyl 4-[2-(2-chlorophenyl)-6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 171502926 |
| Molecular Formula | C23H18ClN3O4 |
| Molecular Weight | 435.87 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | methyl 4-[2-(2-chlorophenyl)-6,8-dioxo-5,7-diazaspiro[3.4]octan-7-yl]isoquinoline-6-carboxylate |
| SMILES | COC(=O)c1ccc2cncc(N3C(=O)NC4(CC(c5ccccc5Cl)C4)C3=O)c2c1 |
| InChI | InChI=1S/C23H18ClN3O4/c1-31-20(28)13-6-7-14-11-25-12-19(17(14)8-13)27-21(29)23(26-22(27)30)9-15(10-23)16-4-2-3-5-18(16)24/h2-8,11-12,15H,9-10H2,1H3,(H,26,30) |
| InChIKey | OVMFVSFBMCRRLF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|