C29H24ClN5O3 — CID 171902773
5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]pyridine-3-carboxamide (PubChem CID 171902773) has the molecular formula C29H24ClN5O3 and a molecular weight of 526.00 g/mol. Its IUPAC name is 5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171902773 |
| Molecular Formula | C29H24ClN5O3 |
| Molecular Weight | 526.00 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(-c2cccc(Cl)c2C2CCC3C(=O)N(c4cncc5ccccc45)C(=O)NC3C2)c1 |
| InChI | InChI=1S/C29H24ClN5O3/c30-23-7-3-6-21(18-10-19(27(31)36)14-32-13-18)26(23)16-8-9-22-24(11-16)34-29(38)35(28(22)37)25-15-33-12-17-4-1-2-5-20(17)25/h1-7,10,12-16,22,24H,8-9,11H2,(H2,31,36)(H,34,38) |
| InChIKey | GPZNUEYACXQQSZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |