About N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide
N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 166333822) has the molecular formula C11H12ClF3N2O4S2
and a molecular weight of 392.81 g/mol. Its IUPAC name is N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 166333822 |
| Molecular Formula | C11H12ClF3N2O4S2 |
| Molecular Weight | 392.81 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | NC1CS(=O)(=O)CC1NS(=O)(=O)c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C11H12ClF3N2O4S2/c12-7-3-6(11(13,14)15)1-2-10(7)23(20,21)17-9-5-22(18,19)4-8(9)16/h1-3,8-9,17H,4-5,16H2 |
| InChIKey | KHGYWCYRZRYQGZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.81 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide (CID 166333822) is N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide is NC1CS(=O)(=O)CC1NS(=O)(=O)c1ccc(C(F)(F)F)cc1Cl.
What is the InChIKey of N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide?
The InChIKey is KHGYWCYRZRYQGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClF3N2O4S2/c12-7-3-6(11(13,14)15)1-2-10(7)23(20,21)17-9-5-22(18,19)4-8(9)16/h1-3,8-9,17H,4-5,16H2.
What are the key properties of N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide?
N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide has a molecular weight of 392.81 g/mol, XLogP of 0.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-1,1-dioxothiolan-3-yl)-2-chloro-4-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 166333822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).