C11H12ClF3N2O2S — CID 171678637
N-[1-(aminomethyl)cyclopropyl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 171678637) has the molecular formula C11H12ClF3N2O2S and a molecular weight of 328.74 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopropyl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[1-(aminomethyl)cyclopropyl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 171678637 |
| Molecular Formula | C11H12ClF3N2O2S |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | N-[1-(aminomethyl)cyclopropyl]-2-chloro-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | NCC1(NS(=O)(=O)c2ccc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C11H12ClF3N2O2S/c12-8-5-7(11(13,14)15)1-2-9(8)20(18,19)17-10(6-16)3-4-10/h1-2,5,17H,3-4,6,16H2 |
| InChIKey | DBHRODCNAIMIAR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |