C25H24N2O4S2 — CID 16633822
3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-(2-oxo-2-thiophen-2-ylethyl)-1,3-thiazolidin-4-one (PubChem CID 16633822) has the molecular formula C25H24N2O4S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-(2-oxo-2-thiophen-2-ylethyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-(2-oxo-2-thiophen-2-ylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16633822 |
| Molecular Formula | C25H24N2O4S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-(2-oxo-2-thiophen-2-ylethyl)-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(/N=C2\SC(CC(=O)c3cccs3)C(=O)N2c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C25H24N2O4S2/c1-3-30-19-11-7-17(8-12-19)26-25-27(18-9-13-20(14-10-18)31-4-2)24(29)23(33-25)16-21(28)22-6-5-15-32-22/h5-15,23H,3-4,16H2,1-2H3/b26-25- |
| InChIKey | RUEFEIAJGURTNR-QPLCGJKRSA-N |
| XLogP | 5.95 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|