C27H25FN2O4S — CID 41180381
(5S)-3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one (PubChem CID 41180381) has the molecular formula C27H25FN2O4S and a molecular weight of 492.57 g/mol. Its IUPAC name is (5S)-3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one.
| Compound Name | (5S)-3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 41180381 |
| Molecular Formula | C27H25FN2O4S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | (5S)-3-(4-ethoxyphenyl)-2-(4-ethoxyphenyl)imino-5-[2-(4-fluorophenyl)-2-oxoethyl]-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccc(/N=C2\S[C@@H](CC(=O)c3ccc(F)cc3)C(=O)N2c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C27H25FN2O4S/c1-3-33-22-13-9-20(10-14-22)29-27-30(21-11-15-23(16-12-21)34-4-2)26(32)25(35-27)17-24(31)18-5-7-19(28)8-6-18/h5-16,25H,3-4,17H2,1-2H3/b29-27-/t25-/m0/s1 |
| InChIKey | KDLRKDPRHRKRSE-MHJKBTLGSA-N |
| XLogP | 6.03 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|