C15H19BrN2O2S2 — CID 166340129
(3R)-N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-5-oxothiomorpholine-3-carboxamide (PubChem CID 166340129) has the molecular formula C15H19BrN2O2S2 and a molecular weight of 403.37 g/mol. Its IUPAC name is (3R)-N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-5-oxothiomorpholine-3-carboxamide.
| Compound Name | (3R)-N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-5-oxothiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 166340129 |
| Molecular Formula | C15H19BrN2O2S2 |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | (3R)-N-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-5-oxothiomorpholine-3-carboxamide |
| SMILES | CC(C)(CNC(=O)[C@@H]1CSCC(=O)N1)Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H19BrN2O2S2/c1-15(2,22-11-5-3-10(16)4-6-11)9-17-14(20)12-7-21-8-13(19)18-12/h3-6,12H,7-9H2,1-2H3,(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | HHMOUYOCDXPMEB-LBPRGKRZSA-N |
| XLogP | 2.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |