C18H19N5O3 — CID 166340166
3-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]azetidine-1,3-dicarboxamide (PubChem CID 166340166) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 3-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]azetidine-1,3-dicarboxamide.
| Compound Name | 3-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]azetidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 166340166 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 3-N-[3-(pyridin-2-ylmethylcarbamoyl)phenyl]azetidine-1,3-dicarboxamide |
| SMILES | NC(=O)N1CC(C(=O)Nc2cccc(C(=O)NCc3ccccn3)c2)C1 |
| InChI | InChI=1S/C18H19N5O3/c19-18(26)23-10-13(11-23)17(25)22-14-6-3-4-12(8-14)16(24)21-9-15-5-1-2-7-20-15/h1-8,13H,9-11H2,(H2,19,26)(H,21,24)(H,22,25) |
| InChIKey | XHHUIWCZGOMNAY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |