C28H30BrClN4O3S — CID 166346529
4-[[2-[4-[[5-(3-bromophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-2-oxoacetyl]amino]-2-chloro-N,N-diethylbenzamide (PubChem CID 166346529) has the molecular formula C28H30BrClN4O3S and a molecular weight of 618.00 g/mol. Its IUPAC name is 4-[[2-[4-[[5-(3-bromophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-2-oxoacetyl]amino]-2-chloro-N,N-diethylbenzamide.
| Compound Name | 4-[[2-[4-[[5-(3-bromophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-2-oxoacetyl]amino]-2-chloro-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 166346529 |
| Molecular Formula | C28H30BrClN4O3S |
| Molecular Weight | 618.00 g/mol |
| Exact Mass | 616.09 |
| IUPAC Name | 4-[[2-[4-[[5-(3-bromophenyl)thiophen-2-yl]methyl]piperazin-1-yl]-2-oxoacetyl]amino]-2-chloro-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)C(=O)N2CCN(Cc3ccc(-c4cccc(Br)c4)s3)CC2)cc1Cl |
| InChI | InChI=1S/C28H30BrClN4O3S/c1-3-33(4-2)27(36)23-10-8-21(17-24(23)30)31-26(35)28(37)34-14-12-32(13-15-34)18-22-9-11-25(38-22)19-6-5-7-20(29)16-19/h5-11,16-17H,3-4,12-15,18H2,1-2H3,(H,31,35) |
| InChIKey | CTCDCOZEROJXFE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.00 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|