C19H24ClNOS — CID 59138595
4-(5-tert-butylthiophen-2-yl)-2-chloro-N,N-diethylbenzamide (PubChem CID 59138595) has the molecular formula C19H24ClNOS and a molecular weight of 349.93 g/mol. Its IUPAC name is 4-(5-tert-butylthiophen-2-yl)-2-chloro-N,N-diethylbenzamide.
| Compound Name | 4-(5-tert-butylthiophen-2-yl)-2-chloro-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 59138595 |
| Molecular Formula | C19H24ClNOS |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-(5-tert-butylthiophen-2-yl)-2-chloro-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(-c2ccc(C(C)(C)C)s2)cc1Cl |
| InChI | InChI=1S/C19H24ClNOS/c1-6-21(7-2)18(22)14-9-8-13(12-15(14)20)16-10-11-17(23-16)19(3,4)5/h8-12H,6-7H2,1-5H3 |
| InChIKey | JVSQVROOLHLNGQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |