C32H32ClF2N5O4 — CID 166346684
2-benzyl-4-[4-[[4-(2-chloro-4-methoxyphenyl)triazol-1-yl]methyl]-3,3-difluoropiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 166346684) has the molecular formula C32H32ClF2N5O4 and a molecular weight of 624.09 g/mol. Its IUPAC name is 2-benzyl-4-[4-[[4-(2-chloro-4-methoxyphenyl)triazol-1-yl]methyl]-3,3-difluoropiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-benzyl-4-[4-[[4-(2-chloro-4-methoxyphenyl)triazol-1-yl]methyl]-3,3-difluoropiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 166346684 |
| Molecular Formula | C32H32ClF2N5O4 |
| Molecular Weight | 624.09 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 2-benzyl-4-[4-[[4-(2-chloro-4-methoxyphenyl)triazol-1-yl]methyl]-3,3-difluoropiperidine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | COc1ccc(-c2cn(CC3CCN(C(=O)C4C(C)C=CC5C(=O)N(Cc6ccccc6)C(=O)C54)CC3(F)F)nn2)c(Cl)c1 |
| InChI | InChI=1S/C32H32ClF2N5O4/c1-19-8-10-24-28(31(43)40(29(24)41)15-20-6-4-3-5-7-20)27(19)30(42)38-13-12-21(32(34,35)18-38)16-39-17-26(36-37-39)23-11-9-22(44-2)14-25(23)33/h3-11,14,17,19,21,24,27-28H,12-13,15-16,18H2,1-2H3 |
| InChIKey | FEOXIJASURCWSV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.09 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|