C35H41BrN6O3 — CID 167770073
2-benzyl-4-[(3S,5R)-4-[[1-[(1R)-1-(4-bromo-3-methylphenyl)ethyl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione (PubChem CID 167770073) has the molecular formula C35H41BrN6O3 and a molecular weight of 673.66 g/mol. Its IUPAC name is 2-benzyl-4-[(3S,5R)-4-[[1-[(1R)-1-(4-bromo-3-methylphenyl)ethyl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-benzyl-4-[(3S,5R)-4-[[1-[(1R)-1-(4-bromo-3-methylphenyl)ethyl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 167770073 |
| Molecular Formula | C35H41BrN6O3 |
| Molecular Weight | 673.66 g/mol |
| Exact Mass | 672.24 |
| IUPAC Name | 2-benzyl-4-[(3S,5R)-4-[[1-[(1R)-1-(4-bromo-3-methylphenyl)ethyl]triazol-4-yl]methyl]-3,5-dimethylpiperazine-1-carbonyl]-5-methyl-3a,4,5,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1cc([C@@H](C)n2cc(CN3[C@H](C)CN(C(=O)C4C(C)C=CC5C(=O)N(Cc6ccccc6)C(=O)C54)C[C@@H]3C)nn2)ccc1Br |
| InChI | InChI=1S/C35H41BrN6O3/c1-21-11-13-29-32(35(45)41(33(29)43)18-26-9-7-6-8-10-26)31(21)34(44)39-16-23(3)40(24(4)17-39)19-28-20-42(38-37-28)25(5)27-12-14-30(36)22(2)15-27/h6-15,20-21,23-25,29,31-32H,16-19H2,1-5H3/t21?,23-,24+,25-,29?,31?,32?/m1/s1 |
| InChIKey | RDQNGECJRQENLM-UDEUNRROSA-N |
| XLogP | 5.00 |
| TPSA | 91.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.66 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|