C18H20BrNOS — CID 166349538
N-(2-bromo-5-methylphenyl)-5-cyclohexylthiophene-3-carboxamide (PubChem CID 166349538) has the molecular formula C18H20BrNOS and a molecular weight of 378.34 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)-5-cyclohexylthiophene-3-carboxamide.
| Compound Name | N-(2-bromo-5-methylphenyl)-5-cyclohexylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 166349538 |
| Molecular Formula | C18H20BrNOS |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)-5-cyclohexylthiophene-3-carboxamide |
| SMILES | Cc1ccc(Br)c(NC(=O)c2csc(C3CCCCC3)c2)c1 |
| InChI | InChI=1S/C18H20BrNOS/c1-12-7-8-15(19)16(9-12)20-18(21)14-10-17(22-11-14)13-5-3-2-4-6-13/h7-11,13H,2-6H2,1H3,(H,20,21) |
| InChIKey | RWPRMUVSZYNUEF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |