C18H19BrClNOS — CID 167757299
N-(2-bromo-6-chloro-4-methylphenyl)-5-cyclohexylthiophene-3-carboxamide (PubChem CID 167757299) has the molecular formula C18H19BrClNOS and a molecular weight of 412.78 g/mol. Its IUPAC name is N-(2-bromo-6-chloro-4-methylphenyl)-5-cyclohexylthiophene-3-carboxamide.
| Compound Name | N-(2-bromo-6-chloro-4-methylphenyl)-5-cyclohexylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 167757299 |
| Molecular Formula | C18H19BrClNOS |
| Molecular Weight | 412.78 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | N-(2-bromo-6-chloro-4-methylphenyl)-5-cyclohexylthiophene-3-carboxamide |
| SMILES | Cc1cc(Cl)c(NC(=O)c2csc(C3CCCCC3)c2)c(Br)c1 |
| InChI | InChI=1S/C18H19BrClNOS/c1-11-7-14(19)17(15(20)8-11)21-18(22)13-9-16(23-10-13)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,21,22) |
| InChIKey | KBIORHCPSWRLBV-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.78 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |