C20H22F3N3O — CID 166351384
4,6-dimethyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide (PubChem CID 166351384) has the molecular formula C20H22F3N3O and a molecular weight of 377.41 g/mol. Its IUPAC name is 4,6-dimethyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide.
| Compound Name | 4,6-dimethyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 166351384 |
| Molecular Formula | C20H22F3N3O |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 4,6-dimethyl-N-[2-(2,2,2-trifluoroethylamino)phenyl]-1,2,3,4-tetrahydroquinoline-8-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccccc2NCC(F)(F)F)c2c(c1)C(C)CCN2 |
| InChI | InChI=1S/C20H22F3N3O/c1-12-9-14-13(2)7-8-24-18(14)15(10-12)19(27)26-17-6-4-3-5-16(17)25-11-20(21,22)23/h3-6,9-10,13,24-25H,7-8,11H2,1-2H3,(H,26,27) |
| InChIKey | ZMADJKCDAFJXQB-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |