C26H20Br2ClN3O5S — CID 166353516
N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2,5-dibromophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 166353516) has the molecular formula C26H20Br2ClN3O5S and a molecular weight of 681.79 g/mol. Its IUPAC name is N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2,5-dibromophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2,5-dibromophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 166353516 |
| Molecular Formula | C26H20Br2ClN3O5S |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 678.92 |
| IUPAC Name | N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]-1-(2,5-dibromophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2C(=O)c3ccccc3C2=O)c(Cl)c1)C1CCN(S(=O)(=O)c2cc(Br)ccc2Br)CC1 |
| InChI | InChI=1S/C26H20Br2ClN3O5S/c27-16-5-7-20(28)23(13-16)38(36,37)31-11-9-15(10-12-31)24(33)30-17-6-8-22(21(29)14-17)32-25(34)18-3-1-2-4-19(18)26(32)35/h1-8,13-15H,9-12H2,(H,30,33) |
| InChIKey | YLASNROZRGYBKU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|