C25H21BrClN3O6S — CID 166353668
[2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(4-chlorophenyl)sulfanyl-3-nitrobenzoate (PubChem CID 166353668) has the molecular formula C25H21BrClN3O6S and a molecular weight of 606.88 g/mol. Its IUPAC name is [2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(4-chlorophenyl)sulfanyl-3-nitrobenzoate.
| Compound Name | [2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(4-chlorophenyl)sulfanyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 166353668 |
| Molecular Formula | C25H21BrClN3O6S |
| Molecular Weight | 606.88 g/mol |
| Exact Mass | 605.00 |
| IUPAC Name | [2-[[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 4-(4-chlorophenyl)sulfanyl-3-nitrobenzoate |
| SMILES | Cc1cc(Br)ccc1NC(=O)CN(C)C(=O)COC(=O)c1ccc(Sc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H21BrClN3O6S/c1-15-11-17(26)4-9-20(15)28-23(31)13-29(2)24(32)14-36-25(33)16-3-10-22(21(12-16)30(34)35)37-19-7-5-18(27)6-8-19/h3-12H,13-14H2,1-2H3,(H,28,31) |
| InChIKey | CLKTWMCAMIDYFO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.88 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|