C27H26N4O3 — CID 166355298
N-[2-(methylamino)-2-oxoethyl]-3-[3-(2-phenyl-1H-indol-3-yl)propanoylamino]benzamide (PubChem CID 166355298) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[2-(methylamino)-2-oxoethyl]-3-[3-(2-phenyl-1H-indol-3-yl)propanoylamino]benzamide.
| Compound Name | N-[2-(methylamino)-2-oxoethyl]-3-[3-(2-phenyl-1H-indol-3-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 166355298 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | N-[2-(methylamino)-2-oxoethyl]-3-[3-(2-phenyl-1H-indol-3-yl)propanoylamino]benzamide |
| SMILES | CNC(=O)CNC(=O)c1cccc(NC(=O)CCc2c(-c3ccccc3)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C27H26N4O3/c1-28-25(33)17-29-27(34)19-10-7-11-20(16-19)30-24(32)15-14-22-21-12-5-6-13-23(21)31-26(22)18-8-3-2-4-9-18/h2-13,16,31H,14-15,17H2,1H3,(H,28,33)(H,29,34)(H,30,32) |
| InChIKey | MWLFOGSRIXYEPT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |