C33H32N4O6S2 — CID 16635613
2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16635613) has the molecular formula C33H32N4O6S2 and a molecular weight of 644.78 g/mol. Its IUPAC name is 2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16635613 |
| Molecular Formula | C33H32N4O6S2 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | 2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CCN(CC)c1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4ccc(O)cc4)c3SC3C(=O)N(c4ccc(OC)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C33H32N4O6S2/c1-4-35(5-2)21-10-6-19(7-11-21)26-27-28(31(41)37(30(27)40)22-12-16-24(43-3)17-13-22)44-32-29(26)45-33(42)36(32)18-25(39)34-20-8-14-23(38)15-9-20/h6-17,26-28,38H,4-5,18H2,1-3H3,(H,34,39)/t26-,27?,28?/m1/s1 |
| InChIKey | PVFMCMCNFUBNMY-VOYUOQKBSA-N |
| XLogP | 4.90 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|