C13H13NO4 — CID 166357885
(E)-3-[4-(pent-3-ynylcarbamoyl)furan-2-yl]prop-2-enoic acid (PubChem CID 166357885) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (E)-3-[4-(pent-3-ynylcarbamoyl)furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(pent-3-ynylcarbamoyl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 166357885 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (E)-3-[4-(pent-3-ynylcarbamoyl)furan-2-yl]prop-2-enoic acid |
| SMILES | CC#CCCNC(=O)c1coc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C13H13NO4/c1-2-3-4-7-14-13(17)10-8-11(18-9-10)5-6-12(15)16/h5-6,8-9H,4,7H2,1H3,(H,14,17)(H,15,16)/b6-5+ |
| InChIKey | OMBJOHQLVIBNNN-AATRIKPKSA-N |
| XLogP | 1.52 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|