C16H12N4O2S — CID 166358633
2-[(3-cyano-2-pyridinyl)amino]ethyl thieno[2,3-c]pyridine-4-carboxylate (PubChem CID 166358633) has the molecular formula C16H12N4O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 2-[(3-cyano-2-pyridinyl)amino]ethyl thieno[2,3-c]pyridine-4-carboxylate.
| Compound Name | 2-[(3-cyano-2-pyridinyl)amino]ethyl thieno[2,3-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 166358633 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-[(3-cyano-2-pyridinyl)amino]ethyl thieno[2,3-c]pyridine-4-carboxylate |
| SMILES | N#Cc1cccnc1NCCOC(=O)c1cncc2sccc12 |
| InChI | InChI=1S/C16H12N4O2S/c17-8-11-2-1-4-19-15(11)20-5-6-22-16(21)13-9-18-10-14-12(13)3-7-23-14/h1-4,7,9-10H,5-6H2,(H,19,20) |
| InChIKey | WBWMLYKXPFRYBB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|