C21H24N4O2 — CID 166360151
(5-tert-butyl-3-pyridinyl)methyl 5-methyl-1-(3-methylphenyl)triazole-4-carboxylate (PubChem CID 166360151) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is (5-tert-butyl-3-pyridinyl)methyl 5-methyl-1-(3-methylphenyl)triazole-4-carboxylate.
| Compound Name | (5-tert-butyl-3-pyridinyl)methyl 5-methyl-1-(3-methylphenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 166360151 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (5-tert-butyl-3-pyridinyl)methyl 5-methyl-1-(3-methylphenyl)triazole-4-carboxylate |
| SMILES | Cc1cccc(-n2nnc(C(=O)OCc3cncc(C(C)(C)C)c3)c2C)c1 |
| InChI | InChI=1S/C21H24N4O2/c1-14-7-6-8-18(9-14)25-15(2)19(23-24-25)20(26)27-13-16-10-17(12-22-11-16)21(3,4)5/h6-12H,13H2,1-5H3 |
| InChIKey | IKFDMOBGUYKUTQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |