C18H13F4N3O2 — CID 42585869
[3-(trifluoromethyl)phenyl]methyl 1-(4-fluorophenyl)-5-methyltriazole-4-carboxylate (PubChem CID 42585869) has the molecular formula C18H13F4N3O2 and a molecular weight of 379.31 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 1-(4-fluorophenyl)-5-methyltriazole-4-carboxylate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 1-(4-fluorophenyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 42585869 |
| Molecular Formula | C18H13F4N3O2 |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 1-(4-fluorophenyl)-5-methyltriazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCc2cccc(C(F)(F)F)c2)nnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H13F4N3O2/c1-11-16(23-24-25(11)15-7-5-14(19)6-8-15)17(26)27-10-12-3-2-4-13(9-12)18(20,21)22/h2-9H,10H2,1H3 |
| InChIKey | HWMGMNQPZYAMJW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |