C29H19BrF3N3O5S2 — CID 16636150
2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16636150) has the molecular formula C29H19BrF3N3O5S2 and a molecular weight of 690.52 g/mol. Its IUPAC name is 2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16636150 |
| Molecular Formula | C29H19BrF3N3O5S2 |
| Molecular Weight | 690.52 g/mol |
| Exact Mass | 688.99 |
| IUPAC Name | 2-[(8S)-8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1cccc(Br)c1)C1C(=O)N(c3ccccc3C(F)(F)F)C(=O)C1S2)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C29H19BrF3N3O5S2/c30-15-5-3-4-14(12-15)21-22-23(26(40)36(25(22)39)19-7-2-1-6-18(19)29(31,32)33)42-27-24(21)43-28(41)35(27)13-20(38)34-16-8-10-17(37)11-9-16/h1-12,21-23,37H,13H2,(H,34,38)/t21-,22?,23?/m1/s1 |
| InChIKey | IFWNURRFPRIEQS-DDRJZQQSSA-N |
| XLogP | 5.83 |
| TPSA | 108.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|