C29H20BrF3N4O6S3 — CID 43848513
2-[8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43848513) has the molecular formula C29H20BrF3N4O6S3 and a molecular weight of 753.60 g/mol. Its IUPAC name is 2-[8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43848513 |
| Molecular Formula | C29H20BrF3N4O6S3 |
| Molecular Weight | 753.60 g/mol |
| Exact Mass | 751.97 |
| IUPAC Name | 2-[8-(3-bromophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)C(c2cccc(Br)c2)C2C(=O)N(c4ccccc4C(F)(F)F)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C29H20BrF3N4O6S3/c30-15-5-3-4-14(12-15)21-22-23(26(40)37(25(22)39)19-7-2-1-6-18(19)29(31,32)33)44-27-24(21)45-28(41)36(27)13-20(38)35-16-8-10-17(11-9-16)46(34,42)43/h1-12,21-23H,13H2,(H,35,38)(H2,34,42,43) |
| InChIKey | WWXJMZJAAVPPCG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|