C20H17F4N5O4S — CID 166363512
N-[(4-amino-2-pyridinyl)methyl]-N'-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]oxamide;2,2,2-trifluoroacetic acid (PubChem CID 166363512) has the molecular formula C20H17F4N5O4S and a molecular weight of 499.45 g/mol. Its IUPAC name is N-[(4-amino-2-pyridinyl)methyl]-N'-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]oxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(4-amino-2-pyridinyl)methyl]-N'-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]oxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166363512 |
| Molecular Formula | C20H17F4N5O4S |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N-[(4-amino-2-pyridinyl)methyl]-N'-[[4-(2-fluorophenyl)-1,3-thiazol-2-yl]methyl]oxamide;2,2,2-trifluoroacetic acid |
| SMILES | Nc1ccnc(CNC(=O)C(=O)NCc2nc(-c3ccccc3F)cs2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H16FN5O2S.C2HF3O2/c19-14-4-2-1-3-13(14)15-10-27-16(24-15)9-23-18(26)17(25)22-8-12-7-11(20)5-6-21-12;3-2(4,5)1(6)7/h1-7,10H,8-9H2,(H2,20,21)(H,22,25)(H,23,26);(H,6,7) |
| InChIKey | OTGKYHIHGMPJFN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 147.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|