C20H22N6O2 — CID 166363737
6-[(2-oxo-1H-quinolin-3-yl)methylamino]-N-piperidin-3-ylpyridazine-3-carboxamide (PubChem CID 166363737) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is 6-[(2-oxo-1H-quinolin-3-yl)methylamino]-N-piperidin-3-ylpyridazine-3-carboxamide.
| Compound Name | 6-[(2-oxo-1H-quinolin-3-yl)methylamino]-N-piperidin-3-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 166363737 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 6-[(2-oxo-1H-quinolin-3-yl)methylamino]-N-piperidin-3-ylpyridazine-3-carboxamide |
| SMILES | O=C(NC1CCCNC1)c1ccc(NCc2cc3ccccc3[nH]c2=O)nn1 |
| InChI | InChI=1S/C20H22N6O2/c27-19-14(10-13-4-1-2-6-16(13)24-19)11-22-18-8-7-17(25-26-18)20(28)23-15-5-3-9-21-12-15/h1-2,4,6-8,10,15,21H,3,5,9,11-12H2,(H,22,26)(H,23,28)(H,24,27) |
| InChIKey | OKRVLLMUIXDSLC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |