C18H19ClN4O4S — CID 166365022
1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)methyl]urea (PubChem CID 166365022) has the molecular formula C18H19ClN4O4S and a molecular weight of 422.89 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)methyl]urea.
| Compound Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 166365022 |
| Molecular Formula | C18H19ClN4O4S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]-3-[(1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)methyl]urea |
| SMILES | Cc1cc(Cl)ccc1OCCNC(=O)NCC1=NS(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C18H19ClN4O4S/c1-12-10-13(19)6-7-15(12)27-9-8-20-18(24)21-11-17-22-14-4-2-3-5-16(14)28(25,26)23-17/h2-7,10H,8-9,11H2,1H3,(H,22,23)(H2,20,21,24) |
| InChIKey | DMQMSIYQJSUGCK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|