C22H17ClFNO3 — CID 166365974
N-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-2-dibenzofuran-2-ylacetamide (PubChem CID 166365974) has the molecular formula C22H17ClFNO3 and a molecular weight of 397.83 g/mol. Its IUPAC name is N-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-2-dibenzofuran-2-ylacetamide.
| Compound Name | N-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-2-dibenzofuran-2-ylacetamide |
|---|---|
| PubChem CID | 166365974 |
| Molecular Formula | C22H17ClFNO3 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N-[2-(2-chloro-6-fluorophenyl)-2-hydroxyethyl]-2-dibenzofuran-2-ylacetamide |
| SMILES | O=C(Cc1ccc2oc3ccccc3c2c1)NCC(O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C22H17ClFNO3/c23-16-5-3-6-17(24)22(16)18(26)12-25-21(27)11-13-8-9-20-15(10-13)14-4-1-2-7-19(14)28-20/h1-10,18,26H,11-12H2,(H,25,27) |
| InChIKey | RRUBLNMKKWKOEK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |