C20H18ClNO2 — CID 166367100
N-[4-(4-chlorophenoxy)phenyl]tricyclo[4.1.0.02,4]heptane-5-carboxamide (PubChem CID 166367100) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is N-[4-(4-chlorophenoxy)phenyl]tricyclo[4.1.0.02,4]heptane-5-carboxamide.
| Compound Name | N-[4-(4-chlorophenoxy)phenyl]tricyclo[4.1.0.02,4]heptane-5-carboxamide |
|---|---|
| PubChem CID | 166367100 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[4-(4-chlorophenoxy)phenyl]tricyclo[4.1.0.02,4]heptane-5-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(Cl)cc2)cc1)C1C2CC2C2CC21 |
| InChI | InChI=1S/C20H18ClNO2/c21-11-1-5-13(6-2-11)24-14-7-3-12(4-8-14)22-20(23)19-17-9-15(17)16-10-18(16)19/h1-8,15-19H,9-10H2,(H,22,23) |
| InChIKey | LMTBMAXSCRRNGR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |