C15H23N3S — CID 166367494
6-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine (PubChem CID 166367494) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 6-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine.
| Compound Name | 6-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
|---|---|
| PubChem CID | 166367494 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 6-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-3-amine |
| SMILES | Cc1ccc(C(C)NC2=NCC3CCC(C)CN23)s1 |
| InChI | InChI=1S/C15H23N3S/c1-10-4-6-13-8-16-15(18(13)9-10)17-12(3)14-7-5-11(2)19-14/h5,7,10,12-13H,4,6,8-9H2,1-3H3,(H,16,17) |
| InChIKey | YVSLPHZNYBETOF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |