C12H12ClN5OS2 — CID 166372681
[2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-(2-hydrazinyl-4-methyl-4,5-dihydroimidazol-1-yl)methanone (PubChem CID 166372681) has the molecular formula C12H12ClN5OS2 and a molecular weight of 341.85 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-(2-hydrazinyl-4-methyl-4,5-dihydroimidazol-1-yl)methanone.
| Compound Name | [2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-(2-hydrazinyl-4-methyl-4,5-dihydroimidazol-1-yl)methanone |
|---|---|
| PubChem CID | 166372681 |
| Molecular Formula | C12H12ClN5OS2 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-1,3-thiazol-4-yl]-(2-hydrazinyl-4-methyl-4,5-dihydroimidazol-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2csc(-c3ccc(Cl)s3)n2)C(NN)=N1 |
| InChI | InChI=1S/C12H12ClN5OS2/c1-6-4-18(12(15-6)17-14)11(19)7-5-20-10(16-7)8-2-3-9(13)21-8/h2-3,5-6H,4,14H2,1H3,(H,15,17) |
| InChIKey | LZBRQLINFGLWRS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|