C14H12ClF3N2OS — CID 166373289
5-[[[4-chloro-3-(trifluoromethyl)phenyl]methylamino]methyl]thiophene-2-carboxamide (PubChem CID 166373289) has the molecular formula C14H12ClF3N2OS and a molecular weight of 348.78 g/mol. Its IUPAC name is 5-[[[4-chloro-3-(trifluoromethyl)phenyl]methylamino]methyl]thiophene-2-carboxamide.
| Compound Name | 5-[[[4-chloro-3-(trifluoromethyl)phenyl]methylamino]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 166373289 |
| Molecular Formula | C14H12ClF3N2OS |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 5-[[[4-chloro-3-(trifluoromethyl)phenyl]methylamino]methyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(CNCc2ccc(Cl)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C14H12ClF3N2OS/c15-11-3-1-8(5-10(11)14(16,17)18)6-20-7-9-2-4-12(22-9)13(19)21/h1-5,20H,6-7H2,(H2,19,21) |
| InChIKey | TUOWFMISJPLLDH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |