C19H16BrClN2O3 — CID 166373423
methyl (3R)-3-(3-bromophenyl)-3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 166373423) has the molecular formula C19H16BrClN2O3 and a molecular weight of 435.71 g/mol. Its IUPAC name is methyl (3R)-3-(3-bromophenyl)-3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | methyl (3R)-3-(3-bromophenyl)-3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 166373423 |
| Molecular Formula | C19H16BrClN2O3 |
| Molecular Weight | 435.71 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | methyl (3R)-3-(3-bromophenyl)-3-[(6-chloro-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)c1cc2ccc(Cl)cc2[nH]1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H16BrClN2O3/c1-26-18(24)10-16(11-3-2-4-13(20)7-11)23-19(25)17-8-12-5-6-14(21)9-15(12)22-17/h2-9,16,22H,10H2,1H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | YZECWNPHEWEFFT-MRXNPFEDSA-N |
| XLogP | 4.62 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |