C20H23N7O2 — CID 166375087
1,3,3-trimethyl-5-[2-(oxolan-2-ylmethyl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]indol-2-one (PubChem CID 166375087) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 1,3,3-trimethyl-5-[2-(oxolan-2-ylmethyl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]indol-2-one.
| Compound Name | 1,3,3-trimethyl-5-[2-(oxolan-2-ylmethyl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]indol-2-one |
|---|---|
| PubChem CID | 166375087 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1,3,3-trimethyl-5-[2-(oxolan-2-ylmethyl)-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazol-3-yl]indol-2-one |
| SMILES | CN1C(=O)C(C)(C)c2cc(-c3nc(-c4ncn[nH]4)nn3CC3CCCO3)ccc21 |
| InChI | InChI=1S/C20H23N7O2/c1-20(2)14-9-12(6-7-15(14)26(3)19(20)28)18-23-17(16-21-11-22-24-16)25-27(18)10-13-5-4-8-29-13/h6-7,9,11,13H,4-5,8,10H2,1-3H3,(H,21,22,24) |
| InChIKey | UFQVVHXBQFALKL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |