C17H19N5O — CID 151677843
1-(oxolan-2-ylmethyl)-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine (PubChem CID 151677843) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine.
| Compound Name | 1-(oxolan-2-ylmethyl)-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine |
|---|---|
| PubChem CID | 151677843 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-5-[4-(1H-1,2,4-triazol-5-yl)phenyl]-2H-pyrazine |
| SMILES | C1=NC(c2ccc(-c3ncn[nH]3)cc2)=CN(CC2CCCO2)C1 |
| InChI | InChI=1S/C17H19N5O/c1-2-15(23-9-1)10-22-8-7-18-16(11-22)13-3-5-14(6-4-13)17-19-12-20-21-17/h3-7,11-12,15H,1-2,8-10H2,(H,19,20,21) |
| InChIKey | QZXAXWMKZXNBOG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |