About methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate
methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate (PubChem CID 166375759) has the molecular formula C14H10ClN3O4S
and a molecular weight of 351.77 g/mol. Its IUPAC name is methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate |
| PubChem CID | 166375759 |
| Molecular Formula | C14H10ClN3O4S |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2cc3scc(Cl)c3[nH]2)c[nH]c1=O |
| InChI | InChI=1S/C14H10ClN3O4S/c1-22-14(21)7-2-6(4-16-12(7)19)17-13(20)9-3-10-11(18-9)8(15)5-23-10/h2-5,18H,1H3,(H,16,19)(H,17,20) |
| InChIKey | CMOOXJBGDRJEJG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate?
The IUPAC name of methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate (CID 166375759) is methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate.
What is the SMILES notation for methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate?
The canonical SMILES for methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate is COC(=O)c1cc(NC(=O)c2cc3scc(Cl)c3[nH]2)c[nH]c1=O.
What is the InChIKey of methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate?
The InChIKey is CMOOXJBGDRJEJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN3O4S/c1-22-14(21)7-2-6(4-16-12(7)19)17-13(20)9-3-10-11(18-9)8(15)5-23-10/h2-5,18H,1H3,(H,16,19)(H,17,20).
What are the key properties of methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate?
methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate has a molecular weight of 351.77 g/mol, XLogP of 2.61, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(3-chloro-4H-thieno[3,2-b]pyrrole-5-carbonyl)amino]-2-oxo-1H-pyridine-3-carboxylate is sourced from PubChem (CID 166375759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).